C10H9BrFN3 — CID 82973962
[3-(4-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methanamine (PubChem CID 82973962) has the molecular formula C10H9BrFN3 and a molecular weight of 270.11 g/mol. Its IUPAC name is [3-(4-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | [3-(4-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82973962 |
| Molecular Formula | C10H9BrFN3 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | [3-(4-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methanamine |
| SMILES | NCc1cc(-c2ccc(Br)cc2F)n[nH]1 |
| InChI | InChI=1S/C10H9BrFN3/c11-6-1-2-8(9(12)3-6)10-4-7(5-13)14-15-10/h1-4H,5,13H2,(H,14,15) |
| InChIKey | RGFFYDNYAOWGEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |