C9H10BrN3S — CID 82488410
2-[3-(4-bromothiophen-2-yl)-1H-pyrazol-5-yl]ethanamine (PubChem CID 82488410) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is 2-[3-(4-bromothiophen-2-yl)-1H-pyrazol-5-yl]ethanamine.
| Compound Name | 2-[3-(4-bromothiophen-2-yl)-1H-pyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82488410 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-[3-(4-bromothiophen-2-yl)-1H-pyrazol-5-yl]ethanamine |
| SMILES | NCCc1cc(-c2cc(Br)cs2)n[nH]1 |
| InChI | InChI=1S/C9H10BrN3S/c10-6-3-9(14-5-6)8-4-7(1-2-11)12-13-8/h3-5H,1-2,11H2,(H,12,13) |
| InChIKey | MVYVXSZDUYCFOI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |