C13H16BrFO3 — CID 82972914
methyl 3-(4-bromo-2-fluorophenyl)-2-ethyl-3-hydroxybutanoate (PubChem CID 82972914) has the molecular formula C13H16BrFO3 and a molecular weight of 319.17 g/mol. Its IUPAC name is methyl 3-(4-bromo-2-fluorophenyl)-2-ethyl-3-hydroxybutanoate.
| Compound Name | methyl 3-(4-bromo-2-fluorophenyl)-2-ethyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82972914 |
| Molecular Formula | C13H16BrFO3 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | methyl 3-(4-bromo-2-fluorophenyl)-2-ethyl-3-hydroxybutanoate |
| SMILES | CCC(C(=O)OC)C(C)(O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFO3/c1-4-9(12(16)18-3)13(2,17)10-6-5-8(14)7-11(10)15/h5-7,9,17H,4H2,1-3H3 |
| InChIKey | PWPPKOOODYADQP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |