C12H11BrF4O2 — CID 58995700
ethyl 4-(4-bromo-2-fluorophenyl)-3,4,4-trifluorobutanoate (PubChem CID 58995700) has the molecular formula C12H11BrF4O2 and a molecular weight of 343.11 g/mol. Its IUPAC name is ethyl 4-(4-bromo-2-fluorophenyl)-3,4,4-trifluorobutanoate.
| Compound Name | ethyl 4-(4-bromo-2-fluorophenyl)-3,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 58995700 |
| Molecular Formula | C12H11BrF4O2 |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | ethyl 4-(4-bromo-2-fluorophenyl)-3,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(F)C(F)(F)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H11BrF4O2/c1-2-19-11(18)6-10(15)12(16,17)8-4-3-7(13)5-9(8)14/h3-5,10H,2,6H2,1H3 |
| InChIKey | VZONZDVOGSDXOJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |