C15H21BrOS — CID 82973207
1-[5-bromo-2-(3-methylcyclohexyl)sulfanylphenyl]ethanol (PubChem CID 82973207) has the molecular formula C15H21BrOS and a molecular weight of 329.30 g/mol. Its IUPAC name is 1-[5-bromo-2-(3-methylcyclohexyl)sulfanylphenyl]ethanol.
| Compound Name | 1-[5-bromo-2-(3-methylcyclohexyl)sulfanylphenyl]ethanol |
|---|---|
| PubChem CID | 82973207 |
| Molecular Formula | C15H21BrOS |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 1-[5-bromo-2-(3-methylcyclohexyl)sulfanylphenyl]ethanol |
| SMILES | CC1CCCC(Sc2ccc(Br)cc2C(C)O)C1 |
| InChI | InChI=1S/C15H21BrOS/c1-10-4-3-5-13(8-10)18-15-7-6-12(16)9-14(15)11(2)17/h6-7,9-11,13,17H,3-5,8H2,1-2H3 |
| InChIKey | OJDASHAMTMHURD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |