C14H19F2NS — CID 63736565
3-(difluoromethyl)-4-(3-methylcyclohexyl)sulfanylaniline (PubChem CID 63736565) has the molecular formula C14H19F2NS and a molecular weight of 271.38 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(3-methylcyclohexyl)sulfanylaniline.
| Compound Name | 3-(difluoromethyl)-4-(3-methylcyclohexyl)sulfanylaniline |
|---|---|
| PubChem CID | 63736565 |
| Molecular Formula | C14H19F2NS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(difluoromethyl)-4-(3-methylcyclohexyl)sulfanylaniline |
| SMILES | CC1CCCC(Sc2ccc(N)cc2C(F)F)C1 |
| InChI | InChI=1S/C14H19F2NS/c1-9-3-2-4-11(7-9)18-13-6-5-10(17)8-12(13)14(15)16/h5-6,8-9,11,14H,2-4,7,17H2,1H3 |
| InChIKey | UNHPYOFMNAVCER-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|