C13H19NS — CID 62722234
4-(3-methylcyclohexyl)sulfanylaniline (PubChem CID 62722234) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 4-(3-methylcyclohexyl)sulfanylaniline.
| Compound Name | 4-(3-methylcyclohexyl)sulfanylaniline |
|---|---|
| PubChem CID | 62722234 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-(3-methylcyclohexyl)sulfanylaniline |
| SMILES | CC1CCCC(Sc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C13H19NS/c1-10-3-2-4-13(9-10)15-12-7-5-11(14)6-8-12/h5-8,10,13H,2-4,9,14H2,1H3 |
| InChIKey | ZWHDPOQTDFPTOA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|