C10H9BrN2OS2 — CID 82973686
1-[5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)phenyl]ethanol (PubChem CID 82973686) has the molecular formula C10H9BrN2OS2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 1-[5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 82973686 |
| Molecular Formula | C10H9BrN2OS2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 1-[5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)phenyl]ethanol |
| SMILES | CC(O)c1cc(Br)ccc1Sc1ncns1 |
| InChI | InChI=1S/C10H9BrN2OS2/c1-6(14)8-4-7(11)2-3-9(8)15-10-12-5-13-16-10/h2-6,14H,1H3 |
| InChIKey | OFYPRWZCXQDKGE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |