C17H24O3 — CID 82976185
methyl 2-[(3-ethylcyclohexyl)oxymethyl]benzoate (PubChem CID 82976185) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl 2-[(3-ethylcyclohexyl)oxymethyl]benzoate.
| Compound Name | methyl 2-[(3-ethylcyclohexyl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 82976185 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | methyl 2-[(3-ethylcyclohexyl)oxymethyl]benzoate |
| SMILES | CCC1CCCC(OCc2ccccc2C(=O)OC)C1 |
| InChI | InChI=1S/C17H24O3/c1-3-13-7-6-9-15(11-13)20-12-14-8-4-5-10-16(14)17(18)19-2/h4-5,8,10,13,15H,3,6-7,9,11-12H2,1-2H3 |
| InChIKey | BSSGDCSKNUNWFX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |