C17H21NO — CID 82978560
2-[1-(N,4-dimethylanilino)propyl]phenol (PubChem CID 82978560) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-[1-(N,4-dimethylanilino)propyl]phenol.
| Compound Name | 2-[1-(N,4-dimethylanilino)propyl]phenol |
|---|---|
| PubChem CID | 82978560 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[1-(N,4-dimethylanilino)propyl]phenol |
| SMILES | CCC(c1ccccc1O)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO/c1-4-16(15-7-5-6-8-17(15)19)18(3)14-11-9-13(2)10-12-14/h5-12,16,19H,4H2,1-3H3 |
| InChIKey | IDJITSKQBKLMIT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|