C13H18BrNO — CID 82979817
4-bromo-2-[(2,2-dimethylpyrrolidin-1-yl)methyl]phenol (PubChem CID 82979817) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 4-bromo-2-[(2,2-dimethylpyrrolidin-1-yl)methyl]phenol.
| Compound Name | 4-bromo-2-[(2,2-dimethylpyrrolidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 82979817 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-bromo-2-[(2,2-dimethylpyrrolidin-1-yl)methyl]phenol |
| SMILES | CC1(C)CCCN1Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C13H18BrNO/c1-13(2)6-3-7-15(13)9-10-8-11(14)4-5-12(10)16/h4-5,8,16H,3,6-7,9H2,1-2H3 |
| InChIKey | XDFTWXBQHAHADU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|