C12H18ClNO4S — CID 82983833
2-chloro-6-methoxy-4-[[methyl(2-methylsulfonylethyl)amino]methyl]phenol (PubChem CID 82983833) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[[methyl(2-methylsulfonylethyl)amino]methyl]phenol.
| Compound Name | 2-chloro-6-methoxy-4-[[methyl(2-methylsulfonylethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82983833 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-chloro-6-methoxy-4-[[methyl(2-methylsulfonylethyl)amino]methyl]phenol |
| SMILES | COc1cc(CN(C)CCS(C)(=O)=O)cc(Cl)c1O |
| InChI | InChI=1S/C12H18ClNO4S/c1-14(4-5-19(3,16)17)8-9-6-10(13)12(15)11(7-9)18-2/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | QVHSEYGCPVGLBB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |