C19H33NO — CID 82984646
1-(4-methoxy-2-methylphenyl)-N,2-dipropylpentan-1-amine (PubChem CID 82984646) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-(4-methoxy-2-methylphenyl)-N,2-dipropylpentan-1-amine.
| Compound Name | 1-(4-methoxy-2-methylphenyl)-N,2-dipropylpentan-1-amine |
|---|---|
| PubChem CID | 82984646 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-(4-methoxy-2-methylphenyl)-N,2-dipropylpentan-1-amine |
| SMILES | CCCNC(c1ccc(OC)cc1C)C(CCC)CCC |
| InChI | InChI=1S/C19H33NO/c1-6-9-16(10-7-2)19(20-13-8-3)18-12-11-17(21-5)14-15(18)4/h11-12,14,16,19-20H,6-10,13H2,1-5H3 |
| InChIKey | VSBZSYJKYVPJKV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |