C13H25N3S — CID 82988154
N-[(5-heptan-4-yl-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine (PubChem CID 82988154) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-[(5-heptan-4-yl-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-heptan-4-yl-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 82988154 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[(5-heptan-4-yl-1,3,4-thiadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(C(CCC)CCC)s1 |
| InChI | InChI=1S/C13H25N3S/c1-4-7-11(8-5-2)13-16-15-12(17-13)10-14-9-6-3/h11,14H,4-10H2,1-3H3 |
| InChIKey | YXNDVNFQGGGGAZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|