C11H15N7O — CID 82989343
3-amino-N-methyl-4-[1-(2H-tetrazol-5-yl)ethylamino]benzamide (PubChem CID 82989343) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is 3-amino-N-methyl-4-[1-(2H-tetrazol-5-yl)ethylamino]benzamide.
| Compound Name | 3-amino-N-methyl-4-[1-(2H-tetrazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 82989343 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-amino-N-methyl-4-[1-(2H-tetrazol-5-yl)ethylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NC(C)c2nn[nH]n2)c(N)c1 |
| InChI | InChI=1S/C11H15N7O/c1-6(10-15-17-18-16-10)14-9-4-3-7(5-8(9)12)11(19)13-2/h3-6,14H,12H2,1-2H3,(H,13,19)(H,15,16,17,18) |
| InChIKey | ZWAQZXBCWYNSSY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|