C12H16N6O — CID 106281246
3-amino-N-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzamide (PubChem CID 106281246) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-amino-N-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzamide.
| Compound Name | 3-amino-N-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 106281246 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-amino-N-methyl-4-[1-(1H-1,2,4-triazol-5-yl)ethylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NC(C)c2ncn[nH]2)c(N)c1 |
| InChI | InChI=1S/C12H16N6O/c1-7(11-15-6-16-18-11)17-10-4-3-8(5-9(10)13)12(19)14-2/h3-7,17H,13H2,1-2H3,(H,14,19)(H,15,16,18) |
| InChIKey | WWHDJCOVZSIOSN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|