C17H24Cl2O2 — CID 82990053
7-chloro-8-(1-chloro-2-propylpentyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 82990053) has the molecular formula C17H24Cl2O2 and a molecular weight of 331.28 g/mol. Its IUPAC name is 7-chloro-8-(1-chloro-2-propylpentyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-chloro-8-(1-chloro-2-propylpentyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 82990053 |
| Molecular Formula | C17H24Cl2O2 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 7-chloro-8-(1-chloro-2-propylpentyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CCCC(CCC)C(Cl)c1cc2c(cc1Cl)OCCCO2 |
| InChI | InChI=1S/C17H24Cl2O2/c1-3-6-12(7-4-2)17(19)13-10-15-16(11-14(13)18)21-9-5-8-20-15/h10-12,17H,3-9H2,1-2H3 |
| InChIKey | JDLIAOUYJNUEEQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|