About 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine
7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 106828451) has the molecular formula C17H22Cl2O2
and a molecular weight of 329.27 g/mol. Its IUPAC name is 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
Molecular Properties
| Compound Name | 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| PubChem CID | 106828451 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC1(C(Cl)c2cc3c(cc2Cl)OCCCO3)CCCCC1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-17(6-3-2-4-7-17)16(19)12-10-14-15(11-13(12)18)21-9-5-8-20-14/h10-11,16H,2-9H2,1H3 |
| InChIKey | XIWZZYOEIIRFSQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The IUPAC name of 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (CID 106828451) is 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The canonical SMILES for 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine is CC1(C(Cl)c2cc3c(cc2Cl)OCCCO3)CCCCC1.
What is the InChIKey of 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine?
The InChIKey is XIWZZYOEIIRFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2O2/c1-17(6-3-2-4-7-17)16(19)12-10-14-15(11-13(12)18)21-9-5-8-20-14/h10-11,16H,2-9H2,1H3.
What are the key properties of 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine?
7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine has a molecular weight of 329.27 g/mol, XLogP of 5.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-8-[chloro-(1-methylcyclohexyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 106828451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).