C13H15N5O3 — CID 82990708
methyl 1-[2-amino-4-(ethylcarbamoyl)phenyl]-1,2,4-triazole-3-carboxylate (PubChem CID 82990708) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl 1-[2-amino-4-(ethylcarbamoyl)phenyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[2-amino-4-(ethylcarbamoyl)phenyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 82990708 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | methyl 1-[2-amino-4-(ethylcarbamoyl)phenyl]-1,2,4-triazole-3-carboxylate |
| SMILES | CCNC(=O)c1ccc(-n2cnc(C(=O)OC)n2)c(N)c1 |
| InChI | InChI=1S/C13H15N5O3/c1-3-15-12(19)8-4-5-10(9(14)6-8)18-7-16-11(17-18)13(20)21-2/h4-7H,3,14H2,1-2H3,(H,15,19) |
| InChIKey | SKHUVNPPRYXURZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|