C11H11N3O7 — CID 82991425
2-[5-carbamoyl-N-(carboxymethyl)-2-nitroanilino]acetic acid (PubChem CID 82991425) has the molecular formula C11H11N3O7 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2-[5-carbamoyl-N-(carboxymethyl)-2-nitroanilino]acetic acid.
| Compound Name | 2-[5-carbamoyl-N-(carboxymethyl)-2-nitroanilino]acetic acid |
|---|---|
| PubChem CID | 82991425 |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-[5-carbamoyl-N-(carboxymethyl)-2-nitroanilino]acetic acid |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C11H11N3O7/c12-11(19)6-1-2-7(14(20)21)8(3-6)13(4-9(15)16)5-10(17)18/h1-3H,4-5H2,(H2,12,19)(H,15,16)(H,17,18) |
| InChIKey | YXMJCZQDHKWPLQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|