C12H16N4O3 — CID 82992525
4-(3-aminoazetidin-1-yl)-N,N-dimethyl-3-nitrobenzamide (PubChem CID 82992525) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(3-aminoazetidin-1-yl)-N,N-dimethyl-3-nitrobenzamide.
| Compound Name | 4-(3-aminoazetidin-1-yl)-N,N-dimethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 82992525 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-(3-aminoazetidin-1-yl)-N,N-dimethyl-3-nitrobenzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CC(N)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O3/c1-14(2)12(17)8-3-4-10(11(5-8)16(18)19)15-6-9(13)7-15/h3-5,9H,6-7,13H2,1-2H3 |
| InChIKey | KSMNYFDNIJHDDZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|