C15H21N3O3 — CID 82993069
N-methyl-4-nitro-3-[(2,2,3,3-tetramethylcyclopropyl)amino]benzamide (PubChem CID 82993069) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-methyl-4-nitro-3-[(2,2,3,3-tetramethylcyclopropyl)amino]benzamide.
| Compound Name | N-methyl-4-nitro-3-[(2,2,3,3-tetramethylcyclopropyl)amino]benzamide |
|---|---|
| PubChem CID | 82993069 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-methyl-4-nitro-3-[(2,2,3,3-tetramethylcyclopropyl)amino]benzamide |
| SMILES | CNC(=O)c1ccc([N+](=O)[O-])c(NC2C(C)(C)C2(C)C)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-14(2)13(15(14,3)4)17-10-8-9(12(19)16-5)6-7-11(10)18(20)21/h6-8,13,17H,1-5H3,(H,16,19) |
| InChIKey | UCCNFJSTUGGDQA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|