C11H22N2O2 — CID 82994252
(Z)-N-[2-(2-methoxyethylamino)ethyl]-2-methylpent-2-enamide (PubChem CID 82994252) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (Z)-N-[2-(2-methoxyethylamino)ethyl]-2-methylpent-2-enamide.
| Compound Name | (Z)-N-[2-(2-methoxyethylamino)ethyl]-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 82994252 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (Z)-N-[2-(2-methoxyethylamino)ethyl]-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCCNCCOC |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-10(2)11(14)13-7-6-12-8-9-15-3/h5,12H,4,6-9H2,1-3H3,(H,13,14)/b10-5- |
| InChIKey | BMFDNJAVZLEUHP-YHYXMXQVSA-N |
| XLogP | 0.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|