C10H14N2O3S — CID 82994503
1-(2,2-dimethyl-3-sulfanylpropyl)-3-nitropyridin-4-one (PubChem CID 82994503) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-sulfanylpropyl)-3-nitropyridin-4-one.
| Compound Name | 1-(2,2-dimethyl-3-sulfanylpropyl)-3-nitropyridin-4-one |
|---|---|
| PubChem CID | 82994503 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(2,2-dimethyl-3-sulfanylpropyl)-3-nitropyridin-4-one |
| SMILES | CC(C)(CS)Cn1ccc(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-10(2,7-16)6-11-4-3-9(13)8(5-11)12(14)15/h3-5,16H,6-7H2,1-2H3 |
| InChIKey | DVSLMWWBBHOQJB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|