C11H17N3O4 — CID 82990807
1-[2-hydroxy-3-(propylamino)propyl]-3-nitropyridin-4-one (PubChem CID 82990807) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(propylamino)propyl]-3-nitropyridin-4-one.
| Compound Name | 1-[2-hydroxy-3-(propylamino)propyl]-3-nitropyridin-4-one |
|---|---|
| PubChem CID | 82990807 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[2-hydroxy-3-(propylamino)propyl]-3-nitropyridin-4-one |
| SMILES | CCCNCC(O)Cn1ccc(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17N3O4/c1-2-4-12-6-9(15)7-13-5-3-11(16)10(8-13)14(17)18/h3,5,8-9,12,15H,2,4,6-7H2,1H3 |
| InChIKey | ZKQLTFJCLPDBIB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|