C9H16N4O3 — CID 61177751
1-(3-nitropyrazol-1-yl)-3-(propylamino)propan-2-ol (PubChem CID 61177751) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(3-nitropyrazol-1-yl)-3-(propylamino)propan-2-ol.
| Compound Name | 1-(3-nitropyrazol-1-yl)-3-(propylamino)propan-2-ol |
|---|---|
| PubChem CID | 61177751 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-(3-nitropyrazol-1-yl)-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H16N4O3/c1-2-4-10-6-8(14)7-12-5-3-9(11-12)13(15)16/h3,5,8,10,14H,2,4,6-7H2,1H3 |
| InChIKey | IKMDQASCMYGWEO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|