C14H20N4O2S — CID 83003730
2-amino-4-cyano-N-(2,6-dimethylpiperidin-1-yl)benzenesulfonamide (PubChem CID 83003730) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(2,6-dimethylpiperidin-1-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(2,6-dimethylpiperidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 83003730 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-amino-4-cyano-N-(2,6-dimethylpiperidin-1-yl)benzenesulfonamide |
| SMILES | CC1CCCC(C)N1NS(=O)(=O)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C14H20N4O2S/c1-10-4-3-5-11(2)18(10)17-21(19,20)14-7-6-12(9-15)8-13(14)16/h6-8,10-11,17H,3-5,16H2,1-2H3 |
| InChIKey | AYYMNEASYWTIFD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|