C11H16ClN3 — CID 83004107
3-chloro-2-N-piperidin-1-ylbenzene-1,2-diamine (PubChem CID 83004107) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 3-chloro-2-N-piperidin-1-ylbenzene-1,2-diamine.
| Compound Name | 3-chloro-2-N-piperidin-1-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 83004107 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-chloro-2-N-piperidin-1-ylbenzene-1,2-diamine |
| SMILES | Nc1cccc(Cl)c1NN1CCCCC1 |
| InChI | InChI=1S/C11H16ClN3/c12-9-5-4-6-10(13)11(9)14-15-7-2-1-3-8-15/h4-6,14H,1-3,7-8,13H2 |
| InChIKey | HPQGLPYCLKJYFJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|