C13H18ClN3O2 — CID 170309032
3-(2-amino-6-chloroanilino)azepane-1-carboxylic acid (PubChem CID 170309032) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-(2-amino-6-chloroanilino)azepane-1-carboxylic acid.
| Compound Name | 3-(2-amino-6-chloroanilino)azepane-1-carboxylic acid |
|---|---|
| PubChem CID | 170309032 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-(2-amino-6-chloroanilino)azepane-1-carboxylic acid |
| SMILES | Nc1cccc(Cl)c1NC1CCCCN(C(=O)O)C1 |
| InChI | InChI=1S/C13H18ClN3O2/c14-10-5-3-6-11(15)12(10)16-9-4-1-2-7-17(8-9)13(18)19/h3,5-6,9,16H,1-2,4,7-8,15H2,(H,18,19) |
| InChIKey | PIVUXICEEPLWDO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|