C13H14ClN5O2 — CID 122552575
(3S)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]pyrrolidine-1-carboxylic acid (PubChem CID 122552575) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is (3S)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122552575 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3S)-3-[(3-amino-6-chloro-1,5-naphthyridin-4-yl)amino]pyrrolidine-1-carboxylic acid |
| SMILES | Nc1cnc2ccc(Cl)nc2c1N[C@H]1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C13H14ClN5O2/c14-10-2-1-9-12(18-10)11(8(15)5-16-9)17-7-3-4-19(6-7)13(20)21/h1-2,5,7H,3-4,6,15H2,(H,16,17)(H,20,21)/t7-/m0/s1 |
| InChIKey | HWYHCNPHEWFBOI-ZETCQYMHSA-N |
| XLogP | 2.03 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|