C15H21N3O4 — CID 138674904
3-[(6-amino-2,3-dihydro-1,4-benzodioxin-5-yl)amino]azepane-1-carboxylic acid (PubChem CID 138674904) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-5-yl)amino]azepane-1-carboxylic acid.
| Compound Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-5-yl)amino]azepane-1-carboxylic acid |
|---|---|
| PubChem CID | 138674904 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[(6-amino-2,3-dihydro-1,4-benzodioxin-5-yl)amino]azepane-1-carboxylic acid |
| SMILES | Nc1ccc2c(c1NC1CCCCN(C(=O)O)C1)OCCO2 |
| InChI | InChI=1S/C15H21N3O4/c16-11-4-5-12-14(22-8-7-21-12)13(11)17-10-3-1-2-6-18(9-10)15(19)20/h4-5,10,17H,1-3,6-9,16H2,(H,19,20) |
| InChIKey | TWSHJTKKSGUIBE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|