C11H13ClN2O — CID 83004186
2-[(2-chloro-1-benzofuran-3-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 83004186) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-[(2-chloro-1-benzofuran-3-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(2-chloro-1-benzofuran-3-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83004186 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[(2-chloro-1-benzofuran-3-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1c(Cl)oc2ccccc12 |
| InChI | InChI=1S/C11H13ClN2O/c1-14(2)13-7-9-8-5-3-4-6-10(8)15-11(9)12/h3-6,13H,7H2,1-2H3 |
| InChIKey | LKNVVWNQYBZULX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|