C13H20N2O2 — CID 83006608
5-methoxy-2-[(piperidin-1-ylamino)methyl]phenol (PubChem CID 83006608) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-methoxy-2-[(piperidin-1-ylamino)methyl]phenol.
| Compound Name | 5-methoxy-2-[(piperidin-1-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 83006608 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 5-methoxy-2-[(piperidin-1-ylamino)methyl]phenol |
| SMILES | COc1ccc(CNN2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-17-12-6-5-11(13(16)9-12)10-14-15-7-3-2-4-8-15/h5-6,9,14,16H,2-4,7-8,10H2,1H3 |
| InChIKey | UGNPLBZROBMLCT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|