C10H12N4O2 — CID 930948
5-methoxy-2-[(1,2,4-triazol-4-ylamino)methyl]phenol (PubChem CID 930948) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-methoxy-2-[(1,2,4-triazol-4-ylamino)methyl]phenol.
| Compound Name | 5-methoxy-2-[(1,2,4-triazol-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 930948 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-methoxy-2-[(1,2,4-triazol-4-ylamino)methyl]phenol |
| SMILES | COc1ccc(CNn2cnnc2)c(O)c1 |
| InChI | InChI=1S/C10H12N4O2/c1-16-9-3-2-8(10(15)4-9)5-13-14-6-11-12-7-14/h2-4,6-7,13,15H,5H2,1H3 |
| InChIKey | QSHJOIJAULQHDE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|