About 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol
4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol (PubChem CID 83009315) has the molecular formula C16H26N2O3
and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol |
| PubChem CID | 83009315 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNN2C(C)CCCC2C)cc(OC)c1O |
| InChI | InChI=1S/C16H26N2O3/c1-11-6-5-7-12(2)18(11)17-10-13-8-14(20-3)16(19)15(9-13)21-4/h8-9,11-12,17,19H,5-7,10H2,1-4H3 |
| InChIKey | VUTNHKHNRLUROL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol?
The IUPAC name of 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol (CID 83009315) is 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol.
What is the SMILES notation for 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol?
The canonical SMILES for 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol is COc1cc(CNN2C(C)CCCC2C)cc(OC)c1O.
What is the InChIKey of 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol?
The InChIKey is VUTNHKHNRLUROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-11-6-5-7-12(2)18(11)17-10-13-8-14(20-3)16(19)15(9-13)21-4/h8-9,11-12,17,19H,5-7,10H2,1-4H3.
What are the key properties of 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol?
4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol has a molecular weight of 294.39 g/mol, XLogP of 2.68, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,6-dimethylpiperidin-1-yl)amino]methyl]-2,6-dimethoxyphenol is sourced from PubChem (CID 83009315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).