C10H16N2O — CID 83013936
1,1-dimethyl-2-(2-phenoxyethyl)hydrazine (PubChem CID 83013936) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,1-dimethyl-2-(2-phenoxyethyl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(2-phenoxyethyl)hydrazine |
|---|---|
| PubChem CID | 83013936 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1,1-dimethyl-2-(2-phenoxyethyl)hydrazine |
| SMILES | CN(C)NCCOc1ccccc1 |
| InChI | InChI=1S/C10H16N2O/c1-12(2)11-8-9-13-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | XIXVVDPYVNYQKS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|