C13H19N3O3 — CID 83015045
1-(1,3-benzodioxol-5-yl)-N-morpholin-4-ylethane-1,2-diamine (PubChem CID 83015045) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-morpholin-4-ylethane-1,2-diamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-morpholin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 83015045 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-morpholin-4-ylethane-1,2-diamine |
| SMILES | NCC(NN1CCOCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19N3O3/c14-8-11(15-16-3-5-17-6-4-16)10-1-2-12-13(7-10)19-9-18-12/h1-2,7,11,15H,3-6,8-9,14H2 |
| InChIKey | GZHQLSVQPRZVKJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |