C12H20N2O2 — CID 83015100
2-[2-(2-ethoxyphenoxy)ethyl]-1,1-dimethylhydrazine (PubChem CID 83015100) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[2-(2-ethoxyphenoxy)ethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[2-(2-ethoxyphenoxy)ethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83015100 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-[2-(2-ethoxyphenoxy)ethyl]-1,1-dimethylhydrazine |
| SMILES | CCOc1ccccc1OCCNN(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-4-15-11-7-5-6-8-12(11)16-10-9-13-14(2)3/h5-8,13H,4,9-10H2,1-3H3 |
| InChIKey | GAOZGXMPNJNWDO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|