C10H19N3O2 — CID 83016127
N-morpholin-4-yl-2-pyrrolidin-3-ylacetamide (PubChem CID 83016127) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-morpholin-4-yl-2-pyrrolidin-3-ylacetamide.
| Compound Name | N-morpholin-4-yl-2-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 83016127 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-morpholin-4-yl-2-pyrrolidin-3-ylacetamide |
| SMILES | O=C(CC1CCNC1)NN1CCOCC1 |
| InChI | InChI=1S/C10H19N3O2/c14-10(7-9-1-2-11-8-9)12-13-3-5-15-6-4-13/h9,11H,1-8H2,(H,12,14) |
| InChIKey | HCNIUXRCCRYMCV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |