C12H18F3N3O3 — CID 83017337
1-(piperidin-1-ylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 83017337) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-(piperidin-1-ylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(piperidin-1-ylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83017337 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(piperidin-1-ylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(NN1CCCCC1)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H18F3N3O3/c13-12(14,15)11(9(19)20)4-7-17(8-11)10(21)16-18-5-2-1-3-6-18/h1-8H2,(H,16,21)(H,19,20) |
| InChIKey | ZYZHCOPIMCSQST-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |