C12H24N4O3 — CID 83020326
2-[ethyl-[(4-methylpiperazin-1-yl)carbamoyl]amino]-2-methylpropanoic acid (PubChem CID 83020326) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[ethyl-[(4-methylpiperazin-1-yl)carbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[(4-methylpiperazin-1-yl)carbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83020326 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[ethyl-[(4-methylpiperazin-1-yl)carbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)NN1CCN(C)CC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H24N4O3/c1-5-16(12(2,3)10(17)18)11(19)13-15-8-6-14(4)7-9-15/h5-9H2,1-4H3,(H,13,19)(H,17,18) |
| InChIKey | QPWXVQYWAIZBTJ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |