About N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine
N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine (PubChem CID 83021019) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine.
Molecular Properties
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine |
| PubChem CID | 83021019 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine |
| SMILES | CN1CCN(NCC2CCOCO2)CC1 |
| InChI | InChI=1S/C10H21N3O2/c1-12-3-5-13(6-4-12)11-8-10-2-7-14-9-15-10/h10-11H,2-9H2,1H3 |
| InChIKey | DPXBLNQWWIVOSR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine?
The IUPAC name of N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine (CID 83021019) is N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine.
What is the SMILES notation for N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine?
The canonical SMILES for N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine is CN1CCN(NCC2CCOCO2)CC1.
What is the InChIKey of N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine?
The InChIKey is DPXBLNQWWIVOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2/c1-12-3-5-13(6-4-12)11-8-10-2-7-14-9-15-10/h10-11H,2-9H2,1H3.
What are the key properties of N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine?
N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine has a molecular weight of 215.30 g/mol, XLogP of -0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dioxan-4-ylmethyl)-4-methylpiperazin-1-amine is sourced from PubChem (CID 83021019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).