C9H19FN2 — CID 83021116
N-(2-fluoroethyl)-2,6-dimethylpiperidin-1-amine (PubChem CID 83021116) has the molecular formula C9H19FN2 and a molecular weight of 174.26 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,6-dimethylpiperidin-1-amine.
| Compound Name | N-(2-fluoroethyl)-2,6-dimethylpiperidin-1-amine |
|---|---|
| PubChem CID | 83021116 |
| Molecular Formula | C9H19FN2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | N-(2-fluoroethyl)-2,6-dimethylpiperidin-1-amine |
| SMILES | CC1CCCC(C)N1NCCF |
| InChI | InChI=1S/C9H19FN2/c1-8-4-3-5-9(2)12(8)11-7-6-10/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | NGKIXXJCWHBNGZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |