C11H20N4O — CID 83021388
N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]morpholin-4-amine (PubChem CID 83021388) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]morpholin-4-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]morpholin-4-amine |
|---|---|
| PubChem CID | 83021388 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-5-yl)methyl]morpholin-4-amine |
| SMILES | CCc1cc(CNN2CCOCC2)n(C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-3-10-8-11(14(2)13-10)9-12-15-4-6-16-7-5-15/h8,12H,3-7,9H2,1-2H3 |
| InChIKey | LTGOXJNUJUYPDJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |