C8H17N3O — CID 83021405
2-amino-N',N'-dimethylcyclopentane-1-carbohydrazide (PubChem CID 83021405) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-amino-N',N'-dimethylcyclopentane-1-carbohydrazide.
| Compound Name | 2-amino-N',N'-dimethylcyclopentane-1-carbohydrazide |
|---|---|
| PubChem CID | 83021405 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-amino-N',N'-dimethylcyclopentane-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C1CCCC1N |
| InChI | InChI=1S/C8H17N3O/c1-11(2)10-8(12)6-4-3-5-7(6)9/h6-7H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | QSACUGQIZOIYGC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|