C15H31N3 — CID 83023844
1-(2,6-dimethylpiperidin-1-yl)-N-propylpiperidin-3-amine (PubChem CID 83023844) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-N-propylpiperidin-3-amine.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-N-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 83023844 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-N-propylpiperidin-3-amine |
| SMILES | CCCNC1CCCN(N2C(C)CCCC2C)C1 |
| InChI | InChI=1S/C15H31N3/c1-4-10-16-15-9-6-11-17(12-15)18-13(2)7-5-8-14(18)3/h13-16H,4-12H2,1-3H3 |
| InChIKey | IPNUQRCQBDZINT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |