C14H18F4N2 — CID 107646128
N-propyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-3-amine (PubChem CID 107646128) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is N-propyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-3-amine.
| Compound Name | N-propyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 107646128 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-propyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-3-amine |
| SMILES | CCCNC1CCCN(c2c(F)c(F)cc(F)c2F)C1 |
| InChI | InChI=1S/C14H18F4N2/c1-2-5-19-9-4-3-6-20(8-9)14-12(17)10(15)7-11(16)13(14)18/h7,9,19H,2-6,8H2,1H3 |
| InChIKey | BALKXYQVIRPEGR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|