C14H18F4N2 — CID 107644985
N-ethyl-3-methyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine (PubChem CID 107644985) has the molecular formula C14H18F4N2 and a molecular weight of 290.30 g/mol. Its IUPAC name is N-ethyl-3-methyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine.
| Compound Name | N-ethyl-3-methyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107644985 |
| Molecular Formula | C14H18F4N2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-ethyl-3-methyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine |
| SMILES | CCNC1CCN(c2c(F)c(F)cc(F)c2F)CC1C |
| InChI | InChI=1S/C14H18F4N2/c1-3-19-11-4-5-20(7-8(11)2)14-12(17)9(15)6-10(16)13(14)18/h6,8,11,19H,3-5,7H2,1-2H3 |
| InChIKey | WKTLKRYFFFFWTN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|