C13H16F4N2 — CID 107644995
N-ethyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine (PubChem CID 107644995) has the molecular formula C13H16F4N2 and a molecular weight of 276.28 g/mol. Its IUPAC name is N-ethyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine.
| Compound Name | N-ethyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107644995 |
| Molecular Formula | C13H16F4N2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-ethyl-1-(2,3,5,6-tetrafluorophenyl)piperidin-4-amine |
| SMILES | CCNC1CCN(c2c(F)c(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C13H16F4N2/c1-2-18-8-3-5-19(6-4-8)13-11(16)9(14)7-10(15)12(13)17/h7-8,18H,2-6H2,1H3 |
| InChIKey | QKUHEHNUFDSAQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|