C15H24F2N4 — CID 167015390
N'-[1-(4-amino-2,6-difluorophenyl)piperidin-4-yl]-N-ethylethane-1,2-diamine (PubChem CID 167015390) has the molecular formula C15H24F2N4 and a molecular weight of 298.38 g/mol. Its IUPAC name is N'-[1-(4-amino-2,6-difluorophenyl)piperidin-4-yl]-N-ethylethane-1,2-diamine.
| Compound Name | N'-[1-(4-amino-2,6-difluorophenyl)piperidin-4-yl]-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 167015390 |
| Molecular Formula | C15H24F2N4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N'-[1-(4-amino-2,6-difluorophenyl)piperidin-4-yl]-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNC1CCN(c2c(F)cc(N)cc2F)CC1 |
| InChI | InChI=1S/C15H24F2N4/c1-2-19-5-6-20-12-3-7-21(8-4-12)15-13(16)9-11(18)10-14(15)17/h9-10,12,19-20H,2-8,18H2,1H3 |
| InChIKey | RFOKASFQAJCSDX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|